Difference between revisions of "CPD-730"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1308 == * common-name: ** glyphosate * smiles: ** c(ncc(=o)[o-])p(o)([o-])=o * inchi-key: ** xddaorkbjwwyjs-uhfffaoysa-l * molecular...") |
(Created page with "Category:metabolite == Metabolite HIF-Alpha == * common-name: ** a hypoxia inducible factor (hif) α subunit == Reaction(s) known to consume the compound == * RXN-1...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HIF-Alpha == |
* common-name: | * common-name: | ||
| − | ** | + | ** a hypoxia inducible factor (hif) α subunit |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11320]] |
| + | * [[RXN-11321]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a hypoxia inducible factor (hif) α subunit}} |
| − | |||
| − | |||
Revision as of 08:30, 15 March 2021
Contents
Metabolite HIF-Alpha
- common-name:
- a hypoxia inducible factor (hif) α subunit
