Difference between revisions of "TRNA-Containing-N7-Methylguanine-46"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Lysidine-tRNA-Ile2 == * common-name: ** a lysidine34 in trnaile2 == Reaction(s) known to consume the compound == == Reaction(s) known to...")
(Created page with "Category:metabolite == Metabolite CPD-13853 == * common-name: ** 8-oxo-dgdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) * inch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Lysidine-tRNA-Ile2 ==
+
== Metabolite CPD-13853 ==
 
* common-name:
 
* common-name:
** a lysidine34 in trnaile2
+
** 8-oxo-dgdp
 +
* smiles:
 +
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
 +
* inchi-key:
 +
** ljmltzsnwocynq-vpeninkcsa-k
 +
* molecular-weight:
 +
** 440.179
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12816]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1961]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a lysidine34 in trnaile2}}
+
{{#set: common-name=8-oxo-dgdp}}
 +
{{#set: inchi-key=inchikey=ljmltzsnwocynq-vpeninkcsa-k}}
 +
{{#set: molecular-weight=440.179}}

Revision as of 08:30, 15 March 2021

Metabolite CPD-13853

  • common-name:
    • 8-oxo-dgdp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • ljmltzsnwocynq-vpeninkcsa-k
  • molecular-weight:
    • 440.179

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality