Difference between revisions of "CPD0-1812"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17352 == * smiles: ** ccc=ccc=ccc=ccccccccccc(=o)[a glycerolipid] * common-name: ** a [glycerolipid]-(11z,14z,17z)-icosatrienoate ==...")
(Created page with "Category:metabolite == Metabolite CPD-15279 == * common-name: ** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide * smiles: ** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17352 ==
+
== Metabolite CPD-15279 ==
 +
* common-name:
 +
** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccccccccccc(=o)[a glycerolipid]
+
** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c
* common-name:
+
* inchi-key:
** a [glycerolipid]-(11z,14z,17z)-icosatrienoate
+
** sjhlsluuwibqns-tylceogasa-m
 +
* molecular-weight:
 +
** 460.481
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16101]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14430]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycerolipid]-(11z,14z,17z)-icosatrienoate}}
+
{{#set: common-name=γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide}}
 +
{{#set: inchi-key=inchikey=sjhlsluuwibqns-tylceogasa-m}}
 +
{{#set: molecular-weight=460.481}}

Revision as of 08:31, 15 March 2021

Metabolite CPD-15279

  • common-name:
    • γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide
  • smiles:
    • c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c
  • inchi-key:
    • sjhlsluuwibqns-tylceogasa-m
  • molecular-weight:
    • 460.481

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality