Difference between revisions of "CPD0-1812"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17352 == * smiles: ** ccc=ccc=ccc=ccccccccccc(=o)[a glycerolipid] * common-name: ** a [glycerolipid]-(11z,14z,17z)-icosatrienoate ==...") |
(Created page with "Category:metabolite == Metabolite CPD-15279 == * common-name: ** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide * smiles: ** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-15279 == |
+ | * common-name: | ||
+ | ** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide | ||
* smiles: | * smiles: | ||
− | ** | + | ** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c |
− | * | + | * inchi-key: |
− | ** | + | ** sjhlsluuwibqns-tylceogasa-m |
+ | * molecular-weight: | ||
+ | ** 460.481 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14430]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide}} |
+ | {{#set: inchi-key=inchikey=sjhlsluuwibqns-tylceogasa-m}} | ||
+ | {{#set: molecular-weight=460.481}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite CPD-15279
- common-name:
- γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide
- smiles:
- c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c
- inchi-key:
- sjhlsluuwibqns-tylceogasa-m
- molecular-weight:
- 460.481