Difference between revisions of "Protein-N-acetyl-D-glucosamine-L-thr"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-OCTAPRENYL-4-HYDROXYBENZOATE == * common-name: ** 3-octaprenyl-4-hydroxybenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
(Created page with "Category:metabolite == Metabolite Deoxyhypusine-Synthase-Lysine == * common-name: ** a [deoxyhypusine synthase]-l-lysine == Reaction(s) known to consume the compound == *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-OCTAPRENYL-4-HYDROXYBENZOATE ==
+
== Metabolite Deoxyhypusine-Synthase-Lysine ==
 
* common-name:
 
* common-name:
** 3-octaprenyl-4-hydroxybenzoate
+
** a [deoxyhypusine synthase]-l-lysine
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c)c)c)c
 
* inchi-key:
 
** utibhebnildqkx-lqokpsqisa-m
 
* molecular-weight:
 
** 682.06
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13415]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
+
* [[RXN-13416]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-octaprenyl-4-hydroxybenzoate}}
+
{{#set: common-name=a [deoxyhypusine synthase]-l-lysine}}
{{#set: inchi-key=inchikey=utibhebnildqkx-lqokpsqisa-m}}
 
{{#set: molecular-weight=682.06}}
 

Revision as of 08:31, 15 March 2021

Metabolite Deoxyhypusine-Synthase-Lysine

  • common-name:
    • a [deoxyhypusine synthase]-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [deoxyhypusine synthase]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.