Difference between revisions of "CPD-15035"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16825 == * common-name: ** (s)-equol 4'-sulfate * smiles: ** c1(c=c(c=c2(occ(cc=12)c3(c=cc(=cc=3)os([o-])(=o)=o)))o) * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite TETRADECANOYL-COA == * common-name: ** myristoyl-coa * smiles: ** cccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-16825 ==
+
== Metabolite TETRADECANOYL-COA ==
 
* common-name:
 
* common-name:
** (s)-equol 4'-sulfate
+
** myristoyl-coa
 
* smiles:
 
* smiles:
** c1(c=c(c=c2(occ(cc=12)c3(c=cc(=cc=3)os([o-])(=o)=o)))o)
+
** cccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** uxojwgsgkuymia-gfccvegcsa-m
+
** duafkxofbzqtqe-qsgbvpjfsa-j
 
* molecular-weight:
 
* molecular-weight:
** 321.324
+
** 973.861
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15589]]
+
* [[2.3.1.97-RXN]]
 +
* [[ACACT7]]
 +
* [[ACACT7h]]
 +
* [[ACACT7m]]
 +
* [[ACOA140OR]]
 +
* [[RXN-17021]]
 +
* [[RXN-17023]]
 +
* [[RXN-9626]]
 +
* [[RXN3O-8214]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15589]]
+
* [[ACACT7]]
 +
* [[RXN3O-8214]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-equol 4'-sulfate}}
+
{{#set: common-name=myristoyl-coa}}
{{#set: inchi-key=inchikey=uxojwgsgkuymia-gfccvegcsa-m}}
+
{{#set: inchi-key=inchikey=duafkxofbzqtqe-qsgbvpjfsa-j}}
{{#set: molecular-weight=321.324}}
+
{{#set: molecular-weight=973.861}}

Revision as of 08:31, 15 March 2021

Metabolite TETRADECANOYL-COA

  • common-name:
    • myristoyl-coa
  • smiles:
    • cccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • duafkxofbzqtqe-qsgbvpjfsa-j
  • molecular-weight:
    • 973.861

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality