Difference between revisions of "16-HYDROXYPALMITATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2184 == * common-name: ** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate * smiles: ** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o...")
(Created page with "Category:metabolite == Metabolite Hex-2-enoyl-ACPs == * common-name: ** a trans hex-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9521 * RXN-96...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2184 ==
+
== Metabolite Hex-2-enoyl-ACPs ==
 
* common-name:
 
* common-name:
** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
+
** a trans hex-2-enoyl-[acp]
* smiles:
 
** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o
 
* inchi-key:
 
** wcjyzufkktynlb-aritwgjrsa-l
 
* molecular-weight:
 
** 210.143
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12070]]
+
* [[RXN-9521]]
 +
* [[RXN-9658]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9520]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate}}
+
{{#set: common-name=a trans hex-2-enoyl-[acp]}}
{{#set: inchi-key=inchikey=wcjyzufkktynlb-aritwgjrsa-l}}
 
{{#set: molecular-weight=210.143}}
 

Revision as of 08:31, 15 March 2021

Metabolite Hex-2-enoyl-ACPs

  • common-name:
    • a trans hex-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a trans hex-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.