Difference between revisions of "Sulfamates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MALTOTRIOSE == * common-name: ** maltotriose * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite Glycerol-1-phosphate == * common-name: ** glycerol 1-phosphate == Reaction(s) known to consume the compound == * GLYCEROL-1-PHOSPHATASE...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Glycerol-1-phosphate == |
* common-name: | * common-name: | ||
| − | ** | + | ** glycerol 1-phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GLYCEROL-1-PHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycerol 1-phosphate}} |
| − | |||
| − | |||
Revision as of 08:31, 15 March 2021
Contents
Metabolite Glycerol-1-phosphate
- common-name:
- glycerol 1-phosphate
