Difference between revisions of "ADENOSYLCOBALAMIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17543 == * common-name: ** dapdiamide e * smiles: ** cc(c)c(c(=o)[o-])nc(=o)c(c[n+])nc(=o)c1(oc(c(=o)n)1) * inchi-key: ** bqmjfercspv...") |
(Created page with "Category:metabolite == Metabolite CPD-2742 == * common-name: ** cotinine * smiles: ** c1(=o)(cc[ch](n(c)1)c2(c=nc=cc=2)) * inchi-key: ** uikrocxwunqspj-vifpvbqesa-n * mole...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-2742 == |
* common-name: | * common-name: | ||
− | ** | + | ** cotinine |
* smiles: | * smiles: | ||
− | ** | + | ** c1(=o)(cc[ch](n(c)1)c2(c=nc=cc=2)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** uikrocxwunqspj-vifpvbqesa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 176.218 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN66-161]] |
+ | * [[RXN66-163]] | ||
+ | * [[RXN66-168]] | ||
+ | * [[RXN66-169]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=cotinine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uikrocxwunqspj-vifpvbqesa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=176.218}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite CPD-2742
- common-name:
- cotinine
- smiles:
- c1(=o)(cc[ch](n(c)1)c2(c=nc=cc=2))
- inchi-key:
- uikrocxwunqspj-vifpvbqesa-n
- molecular-weight:
- 176.218