Difference between revisions of "CPD-12117"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16819 == * common-name: ** 4-methylphenyl sulfate * smiles: ** cc1(c=cc(=cc=1)os(=o)(=o)[o-]) * inchi-key: ** wgnakzgusrvwrh-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite L-ARABITOL == * common-name: ** l-arabinitol * smiles: ** c(c(c(c(co)o)o)o)o * inchi-key: ** hebkchpvoiaqta-imjsidkusa-n * molecular-weig...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-ARABITOL == |
* common-name: | * common-name: | ||
− | ** | + | ** l-arabinitol |
* smiles: | * smiles: | ||
− | ** | + | ** c(c(c(c(co)o)o)o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hebkchpvoiaqta-imjsidkusa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 152.147 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-14102]] |
+ | * [[RXN-8772]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-14102]] |
+ | * [[RXN-8772]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-arabinitol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hebkchpvoiaqta-imjsidkusa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=152.147}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite L-ARABITOL
- common-name:
- l-arabinitol
- smiles:
- c(c(c(c(co)o)o)o)o
- inchi-key:
- hebkchpvoiaqta-imjsidkusa-n
- molecular-weight:
- 152.147