Difference between revisions of "25S-rRNA-adenine-2142"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3041 == * common-name: ** isoliquiritigenin * smiles: ** c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2) * inchi-key: ** dxdrhhkmwqzjht...") |
(Created page with "Category:metabolite == Metabolite DIHYDROLIPOAMIDE == * common-name: ** dihydrolipoamide * smiles: ** c(ccc(n)=o)cc(s)ccs * inchi-key: ** vlyugyakyzetrf-ssdottswsa-n * mol...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DIHYDROLIPOAMIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** dihydrolipoamide |
* smiles: | * smiles: | ||
− | ** | + | ** c(ccc(n)=o)cc(s)ccs |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vlyugyakyzetrf-ssdottswsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 207.348 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[AKGDHe2r]] |
+ | * [[DIHYDLIPACETRANS-RXN]] | ||
+ | * [[PDHe3mr]] | ||
+ | * [[RXN-18331]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[AKGDHe2r]] |
+ | * [[DHRT_LPAREN_2mbcoa_RPAREN_]] | ||
+ | * [[DHRT_LPAREN_ibcoa_RPAREN_]] | ||
+ | * [[PDHe3mr]] | ||
+ | * [[RXN-18331]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dihydrolipoamide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vlyugyakyzetrf-ssdottswsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=207.348}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite DIHYDROLIPOAMIDE
- common-name:
- dihydrolipoamide
- smiles:
- c(ccc(n)=o)cc(s)ccs
- inchi-key:
- vlyugyakyzetrf-ssdottswsa-n
- molecular-weight:
- 207.348