Difference between revisions of "L-2-hydroxyacids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite UMP == * common-name: ** ump * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** djjcxfvjdgthfx-xvfcmesi...") |
(Created page with "Category:metabolite == Metabolite Protein-Tyrosines == * common-name: ** a [protein]-l-tyrosine == Reaction(s) known to consume the compound == * 2.7.10.1-RXN == React...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Protein-Tyrosines == |
* common-name: | * common-name: | ||
− | ** | + | ** a [protein]-l-tyrosine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.7.10.1-RXN]] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]] | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [protein]-l-tyrosine}} |
− | |||
− |
Revision as of 08:31, 15 March 2021
Contents
Metabolite Protein-Tyrosines
- common-name:
- a [protein]-l-tyrosine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-tyrosine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.