Difference between revisions of "GAMMA-LINOLENOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2E-9Z-octadeca-2-9-dienoyl-ACPs == * common-name: ** a (2e,9z)-octadeca-2,9-dienoyl-[acp] == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite CPD-15432 == * common-name: ** β-d-galactosyl-(1→3)-n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosami...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15432 == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-galactosyl-(1→3)-n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol |
| + | * smiles: | ||
| + | ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)([o-])op([o-])(=o)oc1(c(c(c(c(o1)co)o)oc3(oc(co)c(o)c(oc2(oc(co)c(o)c(o)c(o)2))c(nc(=o)c)3))nc(c)=o))c)c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** dthgkyazbnwfmj-rijyeuhmsa-l | ||
| + | * molecular-weight: | ||
| + | ** 1493.79 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14561]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-galactosyl-(1→3)-n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol}} |
| + | {{#set: inchi-key=inchikey=dthgkyazbnwfmj-rijyeuhmsa-l}} | ||
| + | {{#set: molecular-weight=1493.79}} | ||
Revision as of 08:31, 15 March 2021
Contents
Metabolite CPD-15432
- common-name:
- β-d-galactosyl-(1→3)-n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)([o-])op([o-])(=o)oc1(c(c(c(c(o1)co)o)oc3(oc(co)c(o)c(oc2(oc(co)c(o)c(o)c(o)2))c(nc(=o)c)3))nc(c)=o))c)c)c)c)c)c)c
- inchi-key:
- dthgkyazbnwfmj-rijyeuhmsa-l
- molecular-weight:
- 1493.79
