Difference between revisions of "ERGOSTEROL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8093 == * common-name: ** 1-linoleoyl-2-α-linolenoyl-phosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=c...")
(Created page with "Category:metabolite == Metabolite CPD-9768 == * common-name: ** (2e)-hexadecenoate * smiles: ** cccccccccccccc=cc(=o)[o-] * inchi-key: ** zvrmgcsssyzgsm-ccezhusrsa-m * mol...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8093 ==
+
== Metabolite CPD-9768 ==
 
* common-name:
 
* common-name:
** 1-linoleoyl-2-α-linolenoyl-phosphatidylcholine
+
** (2e)-hexadecenoate
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** cccccccccccccc=cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** hzgavpneghqjid-unbchyimsa-n
+
** zvrmgcsssyzgsm-ccezhusrsa-m
 
* molecular-weight:
 
* molecular-weight:
** 780.076
+
** 253.404
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8325]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8324]]
+
* [[RXN-16656]]
* [[RXN-8329]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-linoleoyl-2-α-linolenoyl-phosphatidylcholine}}
+
{{#set: common-name=(2e)-hexadecenoate}}
{{#set: inchi-key=inchikey=hzgavpneghqjid-unbchyimsa-n}}
+
{{#set: inchi-key=inchikey=zvrmgcsssyzgsm-ccezhusrsa-m}}
{{#set: molecular-weight=780.076}}
+
{{#set: molecular-weight=253.404}}

Revision as of 08:31, 15 March 2021

Metabolite CPD-9768

  • common-name:
    • (2e)-hexadecenoate
  • smiles:
    • cccccccccccccc=cc(=o)[o-]
  • inchi-key:
    • zvrmgcsssyzgsm-ccezhusrsa-m
  • molecular-weight:
    • 253.404

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality