Difference between revisions of "CPD-207"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLUCONATE == * common-name: ** d-gluconate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-sqougzdysa-m * molec...")
(Created page with "Category:metabolite == Metabolite CPD-14404 == * common-name: ** 3-oxo-dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLUCONATE ==
+
== Metabolite CPD-14404 ==
 
* common-name:
 
* common-name:
** d-gluconate
+
** 3-oxo-dihomo γ-linolenoyl-coa
 
* smiles:
 
* smiles:
** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
+
** cccccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** rghnjxzeokukbd-sqougzdysa-m
+
** djfxnrbquufios-ddquopdjsa-j
 
* molecular-weight:
 
* molecular-weight:
** 195.149
+
** 1065.958
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUCONOKIN-RXN]]
+
* [[RXN-12968]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUCONATE-5-DEHYDROGENASE-RXN]]
+
* [[RXN-12777]]
* [[GLUCONOLACT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-gluconate}}
+
{{#set: common-name=3-oxo-dihomo γ-linolenoyl-coa}}
{{#set: inchi-key=inchikey=rghnjxzeokukbd-sqougzdysa-m}}
+
{{#set: inchi-key=inchikey=djfxnrbquufios-ddquopdjsa-j}}
{{#set: molecular-weight=195.149}}
+
{{#set: molecular-weight=1065.958}}

Revision as of 08:31, 15 March 2021

Metabolite CPD-14404

  • common-name:
    • 3-oxo-dihomo γ-linolenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • djfxnrbquufios-ddquopdjsa-j
  • molecular-weight:
    • 1065.958

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality