Difference between revisions of "CPD-548"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10600 == * common-name: ** 4-hydroxybenzoyl-acetyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op...")
(Created page with "Category:metabolite == Metabolite Core1 == * common-name: ** core 1 == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * 2.4...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10600 ==
+
== Metabolite Core1 ==
 
* common-name:
 
* common-name:
** 4-hydroxybenzoyl-acetyl-coa
+
** core 1
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
** ovqojjjxnyhopr-fueukbnzsa-j
 
* molecular-weight:
 
** 925.647
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11246]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11245]]
+
* [[2.4.1.122-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-hydroxybenzoyl-acetyl-coa}}
+
{{#set: common-name=core 1}}
{{#set: inchi-key=inchikey=ovqojjjxnyhopr-fueukbnzsa-j}}
 
{{#set: molecular-weight=925.647}}
 

Revision as of 08:31, 15 March 2021

Metabolite Core1

  • common-name:
    • core 1

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality