Difference between revisions of "Apo-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11407 == * common-name: ** thyroxine sulfate * smiles: ** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)...")
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N2-Methylgua-26-Gua27 == * common-name: ** an n2-methylguanine26/guanine27 in trna == Reaction(s) known to consume the co...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11407 ==
+
== Metabolite tRNA-Containing-N2-Methylgua-26-Gua27 ==
 
* common-name:
 
* common-name:
** thyroxine sulfate
+
** an n2-methylguanine26/guanine27 in trna
* smiles:
 
** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
 
* inchi-key:
 
** qyxijuzwssqict-lbprgkrzsa-m
 
* molecular-weight:
 
** 855.924
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12379]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10614]]
+
* [[RXN-12378]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thyroxine sulfate}}
+
{{#set: common-name=an n2-methylguanine26/guanine27 in trna}}
{{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}}
 
{{#set: molecular-weight=855.924}}
 

Revision as of 08:32, 15 March 2021

Metabolite tRNA-Containing-N2-Methylgua-26-Gua27

  • common-name:
    • an n2-methylguanine26/guanine27 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality