Difference between revisions of "PWY0-1295"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12677 CPD-12677] == * common-name: ** 5-chloro-5-deoxyribose 1-phosphate * smiles: ** c(cl)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] == * common-name: ** β-l-fucopyranose * smiles: ** cc1(oc(c(c(c1o)o)o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12677 CPD-12677] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] ==
 
* common-name:
 
* common-name:
** 5-chloro-5-deoxyribose 1-phosphate
+
** β-l-fucopyranose
 
* smiles:
 
* smiles:
** c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1)
+
** cc1(oc(c(c(c1o)o)o)o)
 
* inchi-key:
 
* inchi-key:
** dgviesznpvjdpq-soofdhnksa-l
+
** shzgcjcmobcmkk-kgjvwpdlsa-n
 
* molecular-weight:
 
* molecular-weight:
** 246.541
+
** 164.158
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-5298]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11715]]
+
* [[RXN0-5298]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-chloro-5-deoxyribose 1-phosphate}}
+
{{#set: common-name=β-l-fucopyranose}}
{{#set: inchi-key=inchikey=dgviesznpvjdpq-soofdhnksa-l}}
+
{{#set: inchi-key=inchikey=shzgcjcmobcmkk-kgjvwpdlsa-n}}
{{#set: molecular-weight=246.541}}
+
{{#set: molecular-weight=164.158}}

Revision as of 14:18, 26 August 2019

Metabolite CPD0-1107

  • common-name:
    • β-l-fucopyranose
  • smiles:
    • cc1(oc(c(c(c1o)o)o)o)
  • inchi-key:
    • shzgcjcmobcmkk-kgjvwpdlsa-n
  • molecular-weight:
    • 164.158

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality