Difference between revisions of "PWY-5068"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] == * common-name: ** 3-keto-β-d-galactose * smiles: ** c(o)c1(oc(c(c(c1...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] == * common-name: ** gibberellin a51 * smiles: ** c=c1(c3(cc4(c1)(c([ch]5(c2(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] ==
 
* common-name:
 
* common-name:
** 3-keto-β-d-galactose
+
** gibberellin a51
 
* smiles:
 
* smiles:
** c(o)c1(oc(c(c(c1o)=o)o)o)
+
** c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c2)([ch](cc3)4)5)(c)))c([o-])=o)))
 
* inchi-key:
 
* inchi-key:
** apiqnbnbiiccon-fkmsrsahsa-n
+
** hhdwsdsmwjqura-gbnxxhsssa-m
 
* molecular-weight:
 
* molecular-weight:
** 178.141
+
** 331.388
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[KETOLACTOSE-RXN]]
+
* [[RXN-171]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-keto-β-d-galactose}}
+
{{#set: common-name=gibberellin a51}}
{{#set: inchi-key=inchikey=apiqnbnbiiccon-fkmsrsahsa-n}}
+
{{#set: inchi-key=inchikey=hhdwsdsmwjqura-gbnxxhsssa-m}}
{{#set: molecular-weight=178.141}}
+
{{#set: molecular-weight=331.388}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-482

  • common-name:
    • gibberellin a51
  • smiles:
    • c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c2)([ch](cc3)4)5)(c)))c([o-])=o)))
  • inchi-key:
    • hhdwsdsmwjqura-gbnxxhsssa-m
  • molecular-weight:
    • 331.388

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality