Difference between revisions of "PWY-5857"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] == * common-name: ** 4'-phosphopantetheine * smiles: ** cc(c(o)c(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O] == * common-name: ** pro...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O] ==
 
* common-name:
 
* common-name:
** 4'-phosphopantetheine
+
** prostaglandin d2
 
* smiles:
 
* smiles:
** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-]
+
** cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1)
 
* inchi-key:
 
* inchi-key:
** jdmuprlruumctl-vifpvbqesa-l
+
** bhmbvrspmrccgg-outuxvnysa-m
 
* molecular-weight:
 
* molecular-weight:
** 356.33
+
** 351.462
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PANTEPADENYLYLTRAN-RXN]]
+
* [[1.1.1.188-RXN]]
* [[PANTETHEINE-KINASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.4.14-RXN]]
+
* [[1.1.1.188-RXN]]
* [[P-PANTOCYSDECARB-RXN]]
+
* [[PROSTAGLANDIN-D-SYNTHASE-RXN]]
* [[PANTETHEINE-KINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4'-phosphopantetheine}}
+
{{#set: common-name=prostaglandin d2}}
{{#set: inchi-key=inchikey=jdmuprlruumctl-vifpvbqesa-l}}
+
{{#set: inchi-key=inchikey=bhmbvrspmrccgg-outuxvnysa-m}}
{{#set: molecular-weight=356.33}}
+
{{#set: molecular-weight=351.462}}

Revision as of 14:18, 26 August 2019

Metabolite 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O

  • common-name:
    • prostaglandin d2
  • smiles:
    • cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1)
  • inchi-key:
    • bhmbvrspmrccgg-outuxvnysa-m
  • molecular-weight:
    • 351.462

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality