Difference between revisions of "PWY-6787"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-Ribofuranose D-Ribofuranose] == * common-name: ** d-ribofuranose == Reaction(s) known to cons...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13406 CPD-13406] == * common-name: ** glycyl-l-aspartate * smiles: ** c([n+])c(=o)nc(cc(=o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13406 CPD-13406] == |
* common-name: | * common-name: | ||
| − | ** | + | ** glycyl-l-aspartate |
| + | * smiles: | ||
| + | ** c([n+])c(=o)nc(cc(=o)[o-])c(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** sccpdjaqcxwptf-vkhmyheasa-m | ||
| + | * molecular-weight: | ||
| + | ** 189.147 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6987]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycyl-l-aspartate}} |
| + | {{#set: inchi-key=inchikey=sccpdjaqcxwptf-vkhmyheasa-m}} | ||
| + | {{#set: molecular-weight=189.147}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-13406
- common-name:
- glycyl-l-aspartate
- smiles:
- c([n+])c(=o)nc(cc(=o)[o-])c(=o)[o-]
- inchi-key:
- sccpdjaqcxwptf-vkhmyheasa-m
- molecular-weight:
- 189.147
