Difference between revisions of "PWY0-1329"
Jump to navigation
Jump to search
(Created page with "{{#ask: Category:reaction reconstruction tool::unknown-tool | ?common-name | ?ec-number | ?reconstruction category | ?reconstruction source | ?reconstruction comment |...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12826 CPD-12826] == * common-name: ** folate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc(...") |
||
Line 1: | Line 1: | ||
− | + | [[Category:metabolite]] | |
− | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12826 CPD-12826] == | |
− | + | * common-name: | |
− | + | ** folate | |
− | + | * smiles: | |
− | + | ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3)) | |
− | + | * inchi-key: | |
− | + | ** ovbpiulpvideao-lbprgkrzsa-l | |
− | }} | + | * molecular-weight: |
+ | ** 439.387 | ||
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[DHFOR]] | ||
+ | * [[FOLR2]] | ||
+ | * [[THFOR1]] | ||
+ | * [[THFOR2]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=folate}} | ||
+ | {{#set: inchi-key=inchikey=ovbpiulpvideao-lbprgkrzsa-l}} | ||
+ | {{#set: molecular-weight=439.387}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-12826
- common-name:
- folate
- smiles:
- c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3))
- inchi-key:
- ovbpiulpvideao-lbprgkrzsa-l
- molecular-weight:
- 439.387