Difference between revisions of "PWY-699"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] == * common-name: ** (2r,3s,4s)-leucocyanidin * smiles: ** c3(c(c2(oc1(c=c(c=c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] == * common-name: ** gibberellin a15 (open lactone form) * smiles: ** c=c1(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] ==
 
* common-name:
 
* common-name:
** (2r,3s,4s)-leucocyanidin
+
** gibberellin a15 (open lactone form)
 
* smiles:
 
* smiles:
** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o)
+
** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(co)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
 
* inchi-key:
 
* inchi-key:
** sbzwtshafilote-souvjxgzsa-n
+
** tzgxvfytktwkcu-cxxojbqzsa-l
 
* molecular-weight:
 
* molecular-weight:
** 306.271
+
** 346.422
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-602]]
+
* [[RXN1F-163]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-600]]
+
* [[RXN1F-162]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2r,3s,4s)-leucocyanidin}}
+
{{#set: common-name=gibberellin a15 (open lactone form)}}
{{#set: inchi-key=inchikey=sbzwtshafilote-souvjxgzsa-n}}
+
{{#set: inchi-key=inchikey=tzgxvfytktwkcu-cxxojbqzsa-l}}
{{#set: molecular-weight=306.271}}
+
{{#set: molecular-weight=346.422}}

Revision as of 14:18, 26 August 2019

Metabolite CPD1F-97

  • common-name:
    • gibberellin a15 (open lactone form)
  • smiles:
    • c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(co)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
  • inchi-key:
    • tzgxvfytktwkcu-cxxojbqzsa-l
  • molecular-weight:
    • 346.422

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality