Difference between revisions of "PWY-7143"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] == * common-name: ** dopamine * smiles: ** c(cc1(c=c(c(=cc=1)o)o))[n+] * inc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CTP CTP] == * common-name: ** ctp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CTP CTP] ==
 
* common-name:
 
* common-name:
** dopamine
+
** ctp
 
* smiles:
 
* smiles:
** c(cc1(c=c(c(=cc=1)o)o))[n+]
+
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(n)=nc(=o)2))
 
* inchi-key:
 
* inchi-key:
** vyfyytllbukuhu-uhfffaoysa-o
+
** pcdqprrszkqhhs-xvfcmesisa-j
 
* molecular-weight:
 
* molecular-weight:
** 154.188
+
** 479.127
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+
* [[2.7.7.14-RXN]]
* [[RXN6666-4]]
+
* [[2.7.7.15-RXN]]
* [[RXN6666-9]]
+
* [[2.7.7.60-RXN]]
 +
* [[CDPDIGLYSYN-RXN]]
 +
* [[CHLPCTDh]]
 +
* [[DOLICHOL-KINASE-RXN]]
 +
* [[P-PANTOCYSLIG-RXN]]
 +
* [[RXN-12195]]
 +
* [[RXN-12200]]
 +
* [[RXN-12959]]
 +
* [[RXN-15091]]
 +
* [[RXN-7683]]
 +
* [[RXN0-383]]
 +
* [[RXN0-5515]]
 +
* [[RXN0-723]]
 +
* [[TRNA-CYTIDYLYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-221]]
+
* [[ATCD]]
 +
* [[ATCDm]]
 +
* [[CDPKIN-RXN]]
 +
* [[CTPSYN-RXN]]
 +
* [[RXN-14325]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dopamine}}
+
{{#set: common-name=ctp}}
{{#set: inchi-key=inchikey=vyfyytllbukuhu-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=pcdqprrszkqhhs-xvfcmesisa-j}}
{{#set: molecular-weight=154.188}}
+
{{#set: molecular-weight=479.127}}

Revision as of 14:18, 26 August 2019

Metabolite CTP

  • common-name:
    • ctp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(n)=nc(=o)2))
  • inchi-key:
    • pcdqprrszkqhhs-xvfcmesisa-j
  • molecular-weight:
    • 479.127

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality