Difference between revisions of "PWY-6482"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] == * common-name: ** l-thyroxine acyl β-d-glucuronide * smiles: ** c(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] == * common-name: ** (1s,2r)-1-c-(indol-3-yl)glycerol...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] == |
* common-name: | * common-name: | ||
− | ** | + | ** (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate |
* smiles: | * smiles: | ||
− | ** | + | ** c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o)[o-])o)o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** nqeqtypjsiephw-mnovxskesa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 285.193 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN0-2381]] | ||
+ | * [[TRYPSYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[IGPSYN-RXN]] |
+ | * [[RXN0-2381]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nqeqtypjsiephw-mnovxskesa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=285.193}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite INDOLE-3-GLYCEROL-P
- common-name:
- (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate
- smiles:
- c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o)[o-])o)o)
- inchi-key:
- nqeqtypjsiephw-mnovxskesa-l
- molecular-weight:
- 285.193