Difference between revisions of "PWY-5436"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-methyl-terminal-XPK N-methyl-terminal-XPK] == * common-name: ** an n terminal n-methyl-(a/s)p...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * common-name: ** l-asparagine * smiles: ** c(cc(c(=o)[o-])[n+])(n)=o * inchi-key:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == |
* common-name: | * common-name: | ||
− | ** | + | ** l-asparagine |
+ | * smiles: | ||
+ | ** c(cc(c(=o)[o-])[n+])(n)=o | ||
+ | * inchi-key: | ||
+ | ** dcxyfedjocdnaf-reohclbhsa-n | ||
+ | * molecular-weight: | ||
+ | ** 132.119 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[ASPARAGHYD-RXN]] |
+ | * [[ASPARAGINE--TRNA-LIGASE-RXN]] | ||
+ | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ASNSYNA-RXN]] |
+ | * [[ASNSYNB-RXN]] | ||
+ | * [[RXN-12460]] | ||
+ | * [[RXN0-6982]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-asparagine}} |
+ | {{#set: inchi-key=inchikey=dcxyfedjocdnaf-reohclbhsa-n}} | ||
+ | {{#set: molecular-weight=132.119}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite ASN
- common-name:
- l-asparagine
- smiles:
- c(cc(c(=o)[o-])[n+])(n)=o
- inchi-key:
- dcxyfedjocdnaf-reohclbhsa-n
- molecular-weight:
- 132.119