Difference between revisions of "PWY-6689"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-TRYPTOPHAN 5-HYDROXY-TRYPTOPHAN] == * common-name: ** 5-hydroxy-l-tryptophan * smiles...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine9-in-tRNA Guanine9-in-tRNA] == * common-name: ** a guanine9 in trna == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-TRYPTOPHAN 5-HYDROXY-TRYPTOPHAN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine9-in-tRNA Guanine9-in-tRNA] ==
 
* common-name:
 
* common-name:
** 5-hydroxy-l-tryptophan
+
** a guanine9 in trna
* smiles:
 
** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+]))
 
* inchi-key:
 
** ldcyzajdbxycgn-vifpvbqesa-n
 
* molecular-weight:
 
** 220.227
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN3DJ-170]]
+
* [[RXN-12459]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-hydroxy-l-tryptophan}}
+
{{#set: common-name=a guanine9 in trna}}
{{#set: inchi-key=inchikey=ldcyzajdbxycgn-vifpvbqesa-n}}
 
{{#set: molecular-weight=220.227}}
 

Revision as of 14:18, 26 August 2019

Metabolite Guanine9-in-tRNA

  • common-name:
    • a guanine9 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality