Difference between revisions of "PWY-7282"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * common-name: ** l-asparagine * smiles: ** c(cc(c(=o)[o-])[n+])(n)=o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-methyl-terminal-PPK N-methyl-terminal-PPK] == * common-name: ** an n terminal n-methyl-ppk-[p...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-methyl-terminal-PPK N-methyl-terminal-PPK] == |
* common-name: | * common-name: | ||
− | ** | + | ** an n terminal n-methyl-ppk-[protein] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13228]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13227]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an n terminal n-methyl-ppk-[protein]}} |
− | |||
− |
Revision as of 14:18, 26 August 2019
Contents
Metabolite N-methyl-terminal-PPK
- common-name:
- an n terminal n-methyl-ppk-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n terminal n-methyl-ppk-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.