Difference between revisions of "PWY-5640"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE PREPHENATE] == * common-name: ** prephenate * smiles: ** c(=o)([o-])c(=o)cc1(c(=o)[o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == * common-name: ** (+)-dihydromyricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (+)-dihydromyricetin |
* smiles: | * smiles: | ||
| − | ** c(= | + | ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kjxsixmjhkajod-lsdhhaiusa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 319.247 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-7784]] |
| − | + | * [[RXN-8450]] | |
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7922]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(+)-dihydromyricetin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kjxsixmjhkajod-lsdhhaiusa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=319.247}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-7087
- common-name:
- (+)-dihydromyricetin
- smiles:
- c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o)
- inchi-key:
- kjxsixmjhkajod-lsdhhaiusa-m
- molecular-weight:
- 319.247
