Difference between revisions of "PWY-5669"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14158 CPD-14158] == * common-name: ** nebramycin 5' * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OHyW-58-tRNAPhe OHyW-58-tRNAPhe] == * common-name: ** 7-[4-methoxy-(2-hydroxy-3-amino-3-carboxy...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14158 CPD-14158] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OHyW-58-tRNAPhe OHyW-58-tRNAPhe] ==
 
* common-name:
 
* common-name:
** nebramycin 5'
+
** 7-[4-methoxy-(2-hydroxy-3-amino-3-carboxypropyl)]-wyosine37 in trnaphe
* smiles:
 
** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))o))[n+])o)
 
* inchi-key:
 
** yppfejhohnpklt-pbsuhmdjsa-s
 
* molecular-weight:
 
** 515.583
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14540]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13168]]
+
* [[RXN-14539]]
* [[RXN-15284]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nebramycin 5'}}
+
{{#set: common-name=7-[4-methoxy-(2-hydroxy-3-amino-3-carboxypropyl)]-wyosine37 in trnaphe}}
{{#set: inchi-key=inchikey=yppfejhohnpklt-pbsuhmdjsa-s}}
 
{{#set: molecular-weight=515.583}}
 

Revision as of 14:18, 26 August 2019

Metabolite OHyW-58-tRNAPhe

  • common-name:
    • 7-[4-methoxy-(2-hydroxy-3-amino-3-carboxypropyl)]-wyosine37 in trnaphe

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "7-[4-methoxy-(2-hydroxy-3-amino-3-carboxypropyl)]-wyosine37 in trnaphe" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.