Difference between revisions of "PWY-7254"

Revision as of 14:18, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAPKK-L-serine-or-L-threonine MAPKK-L-serine-or-L-threonine] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URIDINE URIDINE] ==
 * common-name:
-** a [map kinase kinase]-(l-serine/l-threonine)
+** uridine
+* smiles:
+** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
+* inchi-key:
+** drtqhjpvmgbucf-xvfcmesisa-n
+* molecular-weight:
+** 244.204
 == Reaction(s) known to consume the compound ==
-* [[2.7.11.25-RXN]]
+* [[AUPT]]
+* [[DATUP]]
+* [[DCTUP]]
+* [[DGTUP]]
+* [[DTTUP]]
+* [[DUTUP]]
+* [[GTUP]]
+* [[ITUP]]
+* [[URIDINE-NUCLEOSIDASE-RXN]]
+* [[URIDINEKIN-RXN]]
+* [[URKI-RXN]]
+* [[URPHOS-RXN]]
+* [[UTUP]]
 == Reaction(s) known to produce the compound ==
-* [[2.7.11.25-RXN]]
+* [[CYTIDEAM2-RXN]]
+* [[RXN-14025]]
+* [[UMPP]]
+* [[URPHOS-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=a [map kinase kinase]-(l-serine/l-threonine)}}
+{{#set: common-name=uridine}}
+{{#set: inchi-key=inchikey=drtqhjpvmgbucf-xvfcmesisa-n}}
+{{#set: molecular-weight=244.204}}