Difference between revisions of "PWY-5892"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS-tRNAs HIS-tRNAs] == * common-name: ** a trnahis == Reaction(s) known to consume the compoun...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] == * common-name: ** (2e,4e)-tetradecadienoyl-coa * smiles: ** cccccccccc=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS-tRNAs HIS-tRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] ==
 
* common-name:
 
* common-name:
** a trnahis
+
** (2e,4e)-tetradecadienoyl-coa
 +
* smiles:
 +
** cccccccccc=cc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 +
* inchi-key:
 +
** ulogshzmdlrqry-inbgbncrsa-j
 +
* molecular-weight:
 +
** 969.83
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HISTIDINE--TRNA-LIGASE-RXN]]
+
* [[RXN-14715]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trnahis}}
+
{{#set: common-name=(2e,4e)-tetradecadienoyl-coa}}
 +
{{#set: inchi-key=inchikey=ulogshzmdlrqry-inbgbncrsa-j}}
 +
{{#set: molecular-weight=969.83}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-15566

  • common-name:
    • (2e,4e)-tetradecadienoyl-coa
  • smiles:
    • cccccccccc=cc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • ulogshzmdlrqry-inbgbncrsa-j
  • molecular-weight:
    • 969.83

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality