Difference between revisions of "PWY-6115"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] == * common-name: ** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate * smil...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-cytochromes-c551 Reduced-cytochromes-c551] == * common-name: ** a reduced cytochrome c5...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-cytochromes-c551 Reduced-cytochromes-c551] ==
 
* common-name:
 
* common-name:
** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
+
** a reduced cytochrome c551
* smiles:
 
** c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1)
 
* inchi-key:
 
** ycjnyhccoxvyaf-uhfffaoysa-m
 
* molecular-weight:
 
** 222.177
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10721]]
+
* [[RXN-15838]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10721]]
+
* [[RXN-15838]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}}
+
{{#set: common-name=a reduced cytochrome c551}}
{{#set: inchi-key=inchikey=ycjnyhccoxvyaf-uhfffaoysa-m}}
 
{{#set: molecular-weight=222.177}}
 

Revision as of 14:18, 26 August 2019

Metabolite Reduced-cytochromes-c551

  • common-name:
    • a reduced cytochrome c551

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality