Difference between revisions of "PWY-7409"

Revision as of 14:18, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14159 CPD-14159] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-uracil-1939 23S-rRNA-uracil-1939] ==
 * common-name:
-** 6''-o-carbamoylkanamycin b
+** a uracil1939 in 23s rrna
-* smiles:
-** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
-* inchi-key:
-** xcstznjiqfivpe-fqsmhnglsa-s
-* molecular-weight:
-** 531.582
 == Reaction(s) known to consume the compound ==
+* [[RXN-11601]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-14553]]
-* [[RXN-15287]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=6''-o-carbamoylkanamycin b}}
+{{#set: common-name=a uracil1939 in 23s rrna}}
-{{#set: inchi-key=inchikey=xcstznjiqfivpe-fqsmhnglsa-s}}
-{{#set: molecular-weight=531.582}}