Difference between revisions of "PWY-7724"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == * common-name: ** s-formylglutathione * smiles: ** c(nc(=o)c(csc=o)nc(=o)cc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS2-peptidyl-carrier-protein LYS2-peptidyl-carrier-protein] == * common-name: ** an apo-[lys2...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS2-peptidyl-carrier-protein LYS2-peptidyl-carrier-protein] ==
 
* common-name:
 
* common-name:
** s-formylglutathione
+
** an apo-[lys2 peptidyl-carrier-protein]
* smiles:
 
** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
 
* inchi-key:
 
** fhxagoicbfgebf-bqbzgakwsa-m
 
* molecular-weight:
 
** 334.323
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-276]]
+
* [[RXN-16759]]
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2962]]
+
* [[RXN-16759]]
* [[RXN0-276]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-formylglutathione}}
+
{{#set: common-name=an apo-[lys2 peptidyl-carrier-protein]}}
{{#set: inchi-key=inchikey=fhxagoicbfgebf-bqbzgakwsa-m}}
 
{{#set: molecular-weight=334.323}}
 

Revision as of 14:18, 26 August 2019

Metabolite LYS2-peptidyl-carrier-protein

  • common-name:
    • an apo-[lys2 peptidyl-carrier-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an apo-[lys2 peptidyl-carrier-protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.