Difference between revisions of "PWY-5278"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-fucosides Beta-D-fucosides] == * common-name: ** a β-d fucoside == Reaction(s) know...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == * common-name: ** geranyl diphosphate * smiles: ** cc(=cccc(=ccop([o-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == |
* common-name: | * common-name: | ||
| − | ** | + | ** geranyl diphosphate |
| + | * smiles: | ||
| + | ** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c | ||
| + | * inchi-key: | ||
| + | ** gvvpgtzrzfnkds-jxmrogbwsa-k | ||
| + | * molecular-weight: | ||
| + | ** 311.188 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[FPPS]] |
| + | * [[FPPSYN-RXN]] | ||
| + | * [[GPPSYN-RXN]] | ||
| + | * [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[GPPS]] | ||
| + | * [[GPPSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=geranyl diphosphate}} |
| + | {{#set: inchi-key=inchikey=gvvpgtzrzfnkds-jxmrogbwsa-k}} | ||
| + | {{#set: molecular-weight=311.188}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite GERANYL-PP
- common-name:
- geranyl diphosphate
- smiles:
- cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
- inchi-key:
- gvvpgtzrzfnkds-jxmrogbwsa-k
- molecular-weight:
- 311.188
