Difference between revisions of "PWY-7764"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VANILLYL_MANDELATE VANILLYL_MANDELATE] == * common-name: ** vanillyl mandelate * smiles: ** coc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mature-tRNA mature-tRNA] == * common-name: ** mature trna == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VANILLYL_MANDELATE VANILLYL_MANDELATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mature-tRNA mature-tRNA] ==
 
* common-name:
 
* common-name:
** vanillyl mandelate
+
** mature trna
* smiles:
 
** coc1(c(o)=cc=c(c=1)c(o)c(=o)[o-])
 
* inchi-key:
 
** cgqcwmiaepehnq-mrvpvssysa-m
 
* molecular-weight:
 
** 197.167
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10917]]
+
* [[3.1.26.11-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=vanillyl mandelate}}
+
{{#set: common-name=mature trna}}
{{#set: inchi-key=inchikey=cgqcwmiaepehnq-mrvpvssysa-m}}
 
{{#set: molecular-weight=197.167}}
 

Revision as of 14:18, 26 August 2019

Metabolite mature-tRNA

  • common-name:
    • mature trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality