Difference between revisions of "PWY-4321"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIOTHYRONINE LIOTHYRONINE] == * common-name: ** 3,5,3'-triiodo-l-thyronine * smiles: ** c1(c=c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodec-2-enoyl-ACPs Dodec-2-enoyl-ACPs] == * common-name: ** a (2e)-dodec-2-enoyl-[acp] == React...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIOTHYRONINE LIOTHYRONINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodec-2-enoyl-ACPs Dodec-2-enoyl-ACPs] ==
 
* common-name:
 
* common-name:
** 3,5,3'-triiodo-l-thyronine
+
** a (2e)-dodec-2-enoyl-[acp]
* smiles:
 
** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-]))
 
* inchi-key:
 
** auyycjsjgjycds-lbprgkrzsa-n
 
* molecular-weight:
 
** 650.978
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10607]]
+
* [[RXN-9534]]
* [[RXN-10609]]
+
* [[RXN-9661]]
* [[RXN-10615]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9533]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,5,3'-triiodo-l-thyronine}}
+
{{#set: common-name=a (2e)-dodec-2-enoyl-[acp]}}
{{#set: inchi-key=inchikey=auyycjsjgjycds-lbprgkrzsa-n}}
 
{{#set: molecular-weight=650.978}}
 

Revision as of 14:18, 26 August 2019

Metabolite Dodec-2-enoyl-ACPs

  • common-name:
    • a (2e)-dodec-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (2e)-dodec-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.