Difference between revisions of "PWY66-161"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * common-name: ** urate * smiles: ** c12(nc(=o)nc=1c(=o)nc(=o)n2) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITHIOTHREITOL DITHIOTHREITOL] == * common-name: ** l-dithiothreitol * smiles: ** c(s)c(o)c(o)c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITHIOTHREITOL DITHIOTHREITOL] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-dithiothreitol |
* smiles: | * smiles: | ||
| − | ** | + | ** c(s)c(o)c(o)cs |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vhjlvaabsrfdpm-imjsidkusa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 154.242 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.1.4.1-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.1.4.1-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-dithiothreitol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vhjlvaabsrfdpm-imjsidkusa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=154.242}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite DITHIOTHREITOL
- common-name:
- l-dithiothreitol
- smiles:
- c(s)c(o)c(o)cs
- inchi-key:
- vhjlvaabsrfdpm-imjsidkusa-n
- molecular-weight:
- 154.242
