Difference between revisions of "SJ04738"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3766 == * common-name: ** menadione * smiles: ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) * inchi-key: ** mjvavzpdrwsrrc-uhfffaoysa-n * molecula...")
(Created page with "Category:gene == Gene SJ04738 == * transcription-direction: ** negative * right-end-position: ** 54207 * left-end-position: ** 49570 * centisome-position: ** 9.79412 =...")
 
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite CPD-3766 ==
+
== Gene SJ04738 ==
* common-name:
+
* transcription-direction:
** menadione
+
** negative
* smiles:
+
* right-end-position:
** cc2(=cc(c1(c=cc=cc=1c2=o))=o)
+
** 54207
* inchi-key:
+
* left-end-position:
** mjvavzpdrwsrrc-uhfffaoysa-n
+
** 49570
* molecular-weight:
+
* centisome-position:
** 172.183
+
** 9.79412   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[NADH-DEHYDROGENASE-QUINONE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[NADH-DEHYDROGENASE-RXN]]
{{#set: common-name=menadione}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=mjvavzpdrwsrrc-uhfffaoysa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=172.183}}
+
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=54207}}
 +
{{#set: left-end-position=49570}}
 +
{{#set: centisome-position=9.79412    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:10, 18 March 2021

Gene SJ04738

  • transcription-direction:
    • negative
  • right-end-position:
    • 54207
  • left-end-position:
    • 49570
  • centisome-position:
    • 9.79412

Organism(s) associated with this gene

Reaction(s) associated