Difference between revisions of "SJ04738"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3766 == * common-name: ** menadione * smiles: ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) * inchi-key: ** mjvavzpdrwsrrc-uhfffaoysa-n * molecula...") |
(Created page with "Category:gene == Gene SJ04738 == * transcription-direction: ** negative * right-end-position: ** 54207 * left-end-position: ** 49570 * centisome-position: ** 9.79412 =...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ04738 == |
− | * | + | * transcription-direction: |
− | ** | + | ** negative |
− | * | + | * right-end-position: |
− | ** | + | ** 54207 |
− | * | + | * left-end-position: |
− | ** | + | ** 49570 |
− | * | + | * centisome-position: |
− | ** | + | ** 9.79412 |
− | == | + | == Organism(s) associated with this gene == |
− | * [[ | + | * [[S.japonica_carotenoid_curated]] |
− | == Reaction(s) | + | == Reaction(s) associated == |
− | + | * [[NADH-DEHYDROGENASE-RXN]] | |
− | {{#set: | + | ** Category: [[annotation]] |
− | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | {{#set: | + | {{#set: transcription-direction=negative}} |
+ | {{#set: right-end-position=54207}} | ||
+ | {{#set: left-end-position=49570}} | ||
+ | {{#set: centisome-position=9.79412 }} | ||
+ | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
+ | {{#set: nb reaction associated=1}} |
Latest revision as of 11:10, 18 March 2021
Gene SJ04738
- transcription-direction:
- negative
- right-end-position:
- 54207
- left-end-position:
- 49570
- centisome-position:
- 9.79412
Organism(s) associated with this gene
Reaction(s) associated
- NADH-DEHYDROGENASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation