Difference between revisions of "PWY-7943"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == * common-name: ** l-histidinol phosphate * smiles: ** c1(nc=n...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] == * common-name: ** α-d-glucuronate 1-phosphate * smiles: ** c(c1(oc(c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] == |
* common-name: | * common-name: | ||
− | ** | + | ** α-d-glucuronate 1-phosphate |
* smiles: | * smiles: | ||
− | ** c1( | + | ** c(c1(oc(c(c(c1o)o)o)op([o-])([o-])=o))([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** aiqdykmwenwvqj-qiuujyrfsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 271.097 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.7.7.44-RXN]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.7.7.44-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α-d-glucuronate 1-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=aiqdykmwenwvqj-qiuujyrfsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=271.097}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-510
- common-name:
- α-d-glucuronate 1-phosphate
- smiles:
- c(c1(oc(c(c(c1o)o)o)op([o-])([o-])=o))([o-])=o
- inchi-key:
- aiqdykmwenwvqj-qiuujyrfsa-k
- molecular-weight:
- 271.097