Difference between revisions of "Palmitoleoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3486 == * common-name: ** 3-chlorobenzoate * smiles: ** c1(c=c(cl)c=c(c=1)c(=o)[o-]) * inchi-key: ** lulayugmbfyyex-uhfffaoysa-m * mo...") |
(Created page with "Category:metabolite == Metabolite Palmitoleoyl-ACPs == * common-name: ** a palmitoleoyl-[acp] == Reaction(s) known to consume the compound == * 2.3.1.179-RXN * RXN-1...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Palmitoleoyl-ACPs == |
* common-name: | * common-name: | ||
− | ** | + | ** a palmitoleoyl-[acp] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2.3.1.179-RXN]] | ||
+ | * [[RXN-17012]] | ||
+ | * [[RXN-17013]] | ||
+ | * [[RXN-17020]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10661]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a palmitoleoyl-[acp]}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Palmitoleoyl-ACPs
- common-name:
- a palmitoleoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a palmitoleoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.