Difference between revisions of "Guanine1575-in-18StRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8973 == * common-name: ** methyl parathion * smiles: ** cop(oc1(=cc=c(c=c1)[n+](=o)[o-]))(oc)=s * inchi-key: ** rlbiqvvomopohc-uhfffa...") |
(Created page with "Category:metabolite == Metabolite Guanine1575-in-18StRNAs == * common-name: ** a guanine1575 in 18s trna == Reaction(s) known to consume the compound == * RXN-15842 ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Guanine1575-in-18StRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a guanine1575 in 18s trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15842]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a guanine1575 in 18s trna}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Guanine1575-in-18StRNAs
- common-name:
- a guanine1575 in 18s trna
