Difference between revisions of "CPD-9039"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GERANYL-PP == * common-name: ** geranyl diphosphate * smiles: ** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c * inchi-key: ** gvvpgtzrzfn...")
(Created page with "Category:metabolite == Metabolite CPD-9039 == * common-name: ** cobalt-precorrin-2 * smiles: ** cc3(c4(=cc1(=[n+]6(c(c(c1ccc([o-])=o)(cc(=o)[o-])c)=cc2(n5(c(=c(c=2cc(=o)[o...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GERANYL-PP ==
+
== Metabolite CPD-9039 ==
 
* common-name:
 
* common-name:
** geranyl diphosphate
+
** cobalt-precorrin-2
 
* smiles:
 
* smiles:
** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
+
** cc3(c4(=cc1(=[n+]6(c(c(c1ccc([o-])=o)(cc(=o)[o-])c)=cc2(n5(c(=c(c=2cc(=o)[o-])ccc(=o)[o-])cc8(n7(c(c=c(c(ccc(=o)[o-])3)n4[co--]567)=c(c(ccc(=o)[o-])=8)cc([o-])=o))))))))cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** gvvpgtzrzfnkds-jxmrogbwsa-k
+
** lsyvtvrlovexci-urapkpmpsa-e
 
* molecular-weight:
 
* molecular-weight:
** 311.188
+
** 912.701
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FPPS]]
 
* [[FPPSYN-RXN]]
 
* [[GPPSYN-RXN]]
 
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GPPS]]
+
* [[RXN-8759]]
* [[GPPSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=geranyl diphosphate}}
+
{{#set: common-name=cobalt-precorrin-2}}
{{#set: inchi-key=inchikey=gvvpgtzrzfnkds-jxmrogbwsa-k}}
+
{{#set: inchi-key=inchikey=lsyvtvrlovexci-urapkpmpsa-e}}
{{#set: molecular-weight=311.188}}
+
{{#set: molecular-weight=912.701}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-9039

  • common-name:
    • cobalt-precorrin-2
  • smiles:
    • cc3(c4(=cc1(=[n+]6(c(c(c1ccc([o-])=o)(cc(=o)[o-])c)=cc2(n5(c(=c(c=2cc(=o)[o-])ccc(=o)[o-])cc8(n7(c(c=c(c(ccc(=o)[o-])3)n4[co--]567)=c(c(ccc(=o)[o-])=8)cc([o-])=o))))))))cc(=o)[o-]
  • inchi-key:
    • lsyvtvrlovexci-urapkpmpsa-e
  • molecular-weight:
    • 912.701

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality