Difference between revisions of "PWY-6932"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LONG-CHAIN-KETONE LONG-CHAIN-KETONE] == * common-name: ** a ketone == Reaction(s) known to cons...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NOREPINEPHRINE NOREPINEPHRINE] == * common-name: ** (r)-noradrenaline * smiles: ** c1(c=c(o)c(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NOREPINEPHRINE NOREPINEPHRINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-noradrenaline |
| + | * smiles: | ||
| + | ** c1(c=c(o)c(=cc=1c(c[n+])o)o) | ||
| + | * inchi-key: | ||
| + | ** sflshlfxelfnjz-qmmmgpobsa-o | ||
| + | * molecular-weight: | ||
| + | ** 170.188 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-10907]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-noradrenaline}} |
| + | {{#set: inchi-key=inchikey=sflshlfxelfnjz-qmmmgpobsa-o}} | ||
| + | {{#set: molecular-weight=170.188}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite NOREPINEPHRINE
- common-name:
- (r)-noradrenaline
- smiles:
- c1(c=c(o)c(=cc=1c(c[n+])o)o)
- inchi-key:
- sflshlfxelfnjz-qmmmgpobsa-o
- molecular-weight:
- 170.188
