Difference between revisions of "PWY0-522"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * common-name: ** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopipera...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N7-Methylguanine-46 tRNA-Containing-N7-Methylguanine-46] == * common-name: ** a...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N7-Methylguanine-46 tRNA-Containing-N7-Methylguanine-46] ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
+
** an n7-methylguanine46 in trna
* smiles:
 
** c(o)c2(o)(nc(=o)c(o)(cc1(=cc=cc=c1))nc(=o)2)
 
* inchi-key:
 
** pxypzmrmtkvysm-vxgbxaggsa-n
 
* molecular-weight:
 
** 266.253
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15680]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=an n7-methylguanine46 in trna}}
{{#set: inchi-key=inchikey=pxypzmrmtkvysm-vxgbxaggsa-n}}
 
{{#set: molecular-weight=266.253}}
 

Revision as of 14:19, 26 August 2019

Metabolite tRNA-Containing-N7-Methylguanine-46

  • common-name:
    • an n7-methylguanine46 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality