Difference between revisions of "LysW-L-glutamate-5-semialdehyde"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7003 == * common-name: ** tetrahydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)...")
(Created page with "Category:metabolite == Metabolite LysW-L-glutamate-5-semialdehyde == * common-name: ** a [2-aminoadipate carrier protein]-l-glutamate 5-semialdehyde == Reaction(s) known t...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7003 ==
+
== Metabolite LysW-L-glutamate-5-semialdehyde ==
 
* common-name:
 
* common-name:
** tetrahydrogeranylgeranyl diphosphate
+
** a [2-aminoadipate carrier protein]-l-glutamate 5-semialdehyde
* smiles:
 
** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
 
* inchi-key:
 
** vzbgwadxujsbti-pyddkjgssa-k
 
* molecular-weight:
 
** 451.456
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7659]]
+
* [[RXN-15007]]
* [[RXN-7660]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7659]]
+
* [[RXN-15006]]
* [[RXN-7660]]
+
* [[RXN-15007]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetrahydrogeranylgeranyl diphosphate}}
+
{{#set: common-name=a [2-aminoadipate carrier protein]-l-glutamate 5-semialdehyde}}
{{#set: inchi-key=inchikey=vzbgwadxujsbti-pyddkjgssa-k}}
 
{{#set: molecular-weight=451.456}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite LysW-L-glutamate-5-semialdehyde

  • common-name:
    • a [2-aminoadipate carrier protein]-l-glutamate 5-semialdehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [2-aminoadipate carrier protein]-l-glutamate 5-semialdehyde" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.