Difference between revisions of "DOLICHOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12019 == * common-name: ** 5-methoxyindoleacetaldehyde * smiles: ** coc2(c=cc1(=c(c(cc=o)=cn1)c=2)) * inchi-key: ** xvhhcgdxcdkklh-uh...") |
(Created page with "Category:metabolite == Metabolite DOLICHOL == * common-name: ** a dolichol == Reaction(s) known to consume the compound == * DOLICHOL-KINASE-RXN == Reaction(s) known t...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DOLICHOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** a dolichol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DOLICHOL-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9971]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a dolichol}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite DOLICHOL
- common-name:
- a dolichol
