Difference between revisions of "CPD-11673"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRIN_IX == * common-name: ** protoporphyrin ix * smiles: ** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=...")
(Created page with "Category:metabolite == Metabolite CPD-11673 == * common-name: ** 5-hydroxytryptophol glucuronide * smiles: ** c(o)cc1(=cnc3(=c1c=c(oc2(oc(c(=o)o)c(o)c(o)c(o)2))c=c3)) * in...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PROTOPORPHYRIN_IX ==
+
== Metabolite CPD-11673 ==
 
* common-name:
 
* common-name:
** protoporphyrin ix
+
** 5-hydroxytryptophol glucuronide
 
* smiles:
 
* smiles:
** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5)))
+
** c(o)cc1(=cnc3(=c1c=c(oc2(oc(c(=o)o)c(o)c(o)c(o)2))c=c3))
 
* inchi-key:
 
* inchi-key:
** ksfovussgskxfi-ujjxfscmsa-l
+
** nflhlwrxdoxscf-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 560.651
+
** 353.328
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PROTOHEMEFERROCHELAT-RXN]]
 
* [[RXN1F-20]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PPPGO]]
+
* [[RXN-10784]]
* [[PROTOHEMEFERROCHELAT-RXN]]
 
* [[PROTOPORGENOXI-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=protoporphyrin ix}}
+
{{#set: common-name=5-hydroxytryptophol glucuronide}}
{{#set: inchi-key=inchikey=ksfovussgskxfi-ujjxfscmsa-l}}
+
{{#set: inchi-key=inchikey=nflhlwrxdoxscf-uhfffaoysa-n}}
{{#set: molecular-weight=560.651}}
+
{{#set: molecular-weight=353.328}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-11673

  • common-name:
    • 5-hydroxytryptophol glucuronide
  • smiles:
    • c(o)cc1(=cnc3(=c1c=c(oc2(oc(c(=o)o)c(o)c(o)c(o)2))c=c3))
  • inchi-key:
    • nflhlwrxdoxscf-uhfffaoysa-n
  • molecular-weight:
    • 353.328

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality