Difference between revisions of "PWY-4942"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cellodextrins Cellodextrins] == * common-name: ** a cellodextrin == Reaction(s) known to consum...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * common-name: ** dopaquinone * smiles: ** c([o-])(=o)c([n+])cc1(=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** dopaquinone |
| + | * smiles: | ||
| + | ** c([o-])(=o)c([n+])cc1(=cc(=o)c(=o)c=c1) | ||
| + | * inchi-key: | ||
| + | ** ahmiduvksgchau-lurjtmiesa-n | ||
| + | * molecular-weight: | ||
| + | ** 195.174 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[MONOPHENOL-MONOOXYGENASE-RXN]] |
| + | * [[RXN-13061]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dopaquinone}} |
| + | {{#set: inchi-key=inchikey=ahmiduvksgchau-lurjtmiesa-n}} | ||
| + | {{#set: molecular-weight=195.174}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite DOPAQUINONE
- common-name:
- dopaquinone
- smiles:
- c([o-])(=o)c([n+])cc1(=cc(=o)c(=o)c=c1)
- inchi-key:
- ahmiduvksgchau-lurjtmiesa-n
- molecular-weight:
- 195.174
