Difference between revisions of "CPD-67"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14283 == * common-name: ** trans-cerot-2-enoyl-coa * smiles: ** cccccccccccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite CPD-67 == * common-name: ** 2-phosphoglycolate * smiles: ** c(op([o-])(=o)[o-])c([o-])=o * inchi-key: ** ascfnmcahfubco-uhfffaoysa-k * mo...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14283 ==
+
== Metabolite CPD-67 ==
 
* common-name:
 
* common-name:
** trans-cerot-2-enoyl-coa
+
** 2-phosphoglycolate
 
* smiles:
 
* smiles:
** cccccccccccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
+
** c(op([o-])(=o)[o-])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** gguuxbbwtgiige-kesudtcvsa-j
+
** ascfnmcahfubco-uhfffaoysa-k
 
* molecular-weight:
 
* molecular-weight:
** 1140.167
+
** 153.008
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GPH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13305]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-cerot-2-enoyl-coa}}
+
{{#set: common-name=2-phosphoglycolate}}
{{#set: inchi-key=inchikey=gguuxbbwtgiige-kesudtcvsa-j}}
+
{{#set: inchi-key=inchikey=ascfnmcahfubco-uhfffaoysa-k}}
{{#set: molecular-weight=1140.167}}
+
{{#set: molecular-weight=153.008}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-67

  • common-name:
    • 2-phosphoglycolate
  • smiles:
    • c(op([o-])(=o)[o-])c([o-])=o
  • inchi-key:
    • ascfnmcahfubco-uhfffaoysa-k
  • molecular-weight:
    • 153.008

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality