Difference between revisions of "CPD-67"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14283 == * common-name: ** trans-cerot-2-enoyl-coa * smiles: ** cccccccccccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)...") |
(Created page with "Category:metabolite == Metabolite CPD-67 == * common-name: ** 2-phosphoglycolate * smiles: ** c(op([o-])(=o)[o-])c([o-])=o * inchi-key: ** ascfnmcahfubco-uhfffaoysa-k * mo...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-67 == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-phosphoglycolate |
* smiles: | * smiles: | ||
− | ** | + | ** c(op([o-])(=o)[o-])c([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ascfnmcahfubco-uhfffaoysa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 153.008 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[GPH-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-phosphoglycolate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ascfnmcahfubco-uhfffaoysa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=153.008}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-67
- common-name:
- 2-phosphoglycolate
- smiles:
- c(op([o-])(=o)[o-])c([o-])=o
- inchi-key:
- ascfnmcahfubco-uhfffaoysa-k
- molecular-weight:
- 153.008